C26H22N2O4 — CID 27659554
5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-2-(4-ethoxyphenyl)isoindole-1,3-dione (PubChem CID 27659554) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-2-(4-ethoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-2-(4-ethoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 27659554 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-2-(4-ethoxyphenyl)isoindole-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)N4CCc5ccccc5C4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O4/c1-2-32-21-10-8-20(9-11-21)28-25(30)22-12-7-18(15-23(22)26(28)31)24(29)27-14-13-17-5-3-4-6-19(17)16-27/h3-12,15H,2,13-14,16H2,1H3 |
| InChIKey | PUBDNCIFTULDFH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|