C29H26ClN3O4 — CID 1408516
3-chloro-4-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]anilino]-1-(4-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 1408516) has the molecular formula C29H26ClN3O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is 3-chloro-4-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]anilino]-1-(4-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]anilino]-1-(4-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1408516 |
| Molecular Formula | C29H26ClN3O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 3-chloro-4-[4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]anilino]-1-(4-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C(Cl)=C(Nc3ccc(CC(=O)N4CCc5ccccc5C4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H26ClN3O4/c1-2-37-24-13-11-23(12-14-24)33-28(35)26(30)27(29(33)36)31-22-9-7-19(8-10-22)17-25(34)32-16-15-20-5-3-4-6-21(20)18-32/h3-14,31H,2,15-18H2,1H3 |
| InChIKey | IFTYDYRNAGTUBY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|