C10H12ClN — CID 14927956
N-(2,6-dimethylphenyl)ethanimidoyl chloride (PubChem CID 14927956) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)ethanimidoyl chloride.
| Compound Name | N-(2,6-dimethylphenyl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 14927956 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | N-(2,6-dimethylphenyl)ethanimidoyl chloride |
| SMILES | C/C(Cl)=N\c1c(C)cccc1C |
| InChI | InChI=1S/C10H12ClN/c1-7-5-4-6-8(2)10(7)12-9(3)11/h4-6H,1-3H3/b12-9+ |
| InChIKey | KIGZHYRFWMDMNA-FMIVXFBMSA-N |
| XLogP | 3.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|