N-(2,6-dimethylphenyl)ethanimidoyl chloride

C10H12ClN — CID 14927956

IUPACN-(2,6-dimethylphenyl)ethanimidoyl chloride
SMILESC/C(Cl)=N\c1c(C)cccc1C
InChIInChI=1S/C10H12ClN/c1-7-5-4-6-8(2)10(7)12-9(3)11/h4-6H,1-3H3/b12-9+
InChIKeyKIGZHYRFWMDMNA-FMIVXFBMSA-N
MW181.67 g/mol
LogP3.59
Rot. Bonds1

About N-(2,6-dimethylphenyl)ethanimidoyl chloride

N-(2,6-dimethylphenyl)ethanimidoyl chloride (PubChem CID 14927956) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)ethanimidoyl chloride.

Molecular Properties

Compound NameN-(2,6-dimethylphenyl)ethanimidoyl chloride
PubChem CID14927956
Molecular FormulaC10H12ClN
Molecular Weight181.67 g/mol
Exact Mass181.07
IUPAC NameN-(2,6-dimethylphenyl)ethanimidoyl chloride
SMILESC/C(Cl)=N\c1c(C)cccc1C
InChIInChI=1S/C10H12ClN/c1-7-5-4-6-8(2)10(7)12-9(3)11/h4-6H,1-3H3/b12-9+
InChIKeyKIGZHYRFWMDMNA-FMIVXFBMSA-N
XLogP3.59
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.67
LogP ≤ 53.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-(2,6-dimethylphenyl)ethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,6-dimethylphenyl)ethanimidoyl chloride?
The IUPAC name of N-(2,6-dimethylphenyl)ethanimidoyl chloride (CID 14927956) is N-(2,6-dimethylphenyl)ethanimidoyl chloride.
What is the SMILES notation for N-(2,6-dimethylphenyl)ethanimidoyl chloride?
The canonical SMILES for N-(2,6-dimethylphenyl)ethanimidoyl chloride is C/C(Cl)=N\c1c(C)cccc1C.
What is the InChIKey of N-(2,6-dimethylphenyl)ethanimidoyl chloride?
The InChIKey is KIGZHYRFWMDMNA-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H12ClN/c1-7-5-4-6-8(2)10(7)12-9(3)11/h4-6H,1-3H3/b12-9+.
What are the key properties of N-(2,6-dimethylphenyl)ethanimidoyl chloride?
N-(2,6-dimethylphenyl)ethanimidoyl chloride has a molecular weight of 181.67 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)ethanimidoyl chloride is sourced from PubChem (CID 14927956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).