C16H16Cl2NTi- — CID 58765924
dichlorotitanium;N-(2,6-dimethylphenyl)-1-phenylethanimine (PubChem CID 58765924) has the molecular formula C16H16Cl2NTi- and a molecular weight of 341.08 g/mol. Its IUPAC name is dichlorotitanium;N-(2,6-dimethylphenyl)-1-phenylethanimine.
| Compound Name | dichlorotitanium;N-(2,6-dimethylphenyl)-1-phenylethanimine |
|---|---|
| PubChem CID | 58765924 |
| Molecular Formula | C16H16Cl2NTi- |
| Molecular Weight | 341.08 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | dichlorotitanium;N-(2,6-dimethylphenyl)-1-phenylethanimine |
| SMILES | C/C(=N\c1c(C)cccc1C)c1[c-]cccc1.Cl[Ti]Cl |
| InChI | InChI=1S/C16H16N.2ClH.Ti/c1-12-8-7-9-13(2)16(12)17-14(3)15-10-5-4-6-11-15;;;/h4-10H,1-3H3;2*1H;/q-1;;;+2/p-2/b17-14+;;; |
| InChIKey | HWZQBZKAXVEAME-AUQFLERXSA-L |
| XLogP | 5.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.08 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|