C15H22ClN — CID 15323894
N-(2,6-dimethylphenyl)heptanimidoyl chloride (PubChem CID 15323894) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)heptanimidoyl chloride.
| Compound Name | N-(2,6-dimethylphenyl)heptanimidoyl chloride |
|---|---|
| PubChem CID | 15323894 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)heptanimidoyl chloride |
| SMILES | CCCCCC/C(Cl)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C15H22ClN/c1-4-5-6-7-11-14(16)17-15-12(2)9-8-10-13(15)3/h8-10H,4-7,11H2,1-3H3/b17-14- |
| InChIKey | QXWHADGYPTYBFC-VKAVYKQESA-N |
| XLogP | 5.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|