C8H9Cl2NV — CID 11258603
dichloro-(2,6-dimethylphenyl)iminovanadium (PubChem CID 11258603) has the molecular formula C8H9Cl2NV and a molecular weight of 241.02 g/mol. Its IUPAC name is dichloro-(2,6-dimethylphenyl)iminovanadium.
| Compound Name | dichloro-(2,6-dimethylphenyl)iminovanadium |
|---|---|
| PubChem CID | 11258603 |
| Molecular Formula | C8H9Cl2NV |
| Molecular Weight | 241.02 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | dichloro-(2,6-dimethylphenyl)iminovanadium |
| SMILES | Cc1cccc(C)c1N=[V](Cl)Cl |
| InChI | InChI=1S/C8H9N.2ClH.V/c1-6-4-3-5-7(2)8(6)9;;;/h3-5H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FAAZBOIFGJSFDB-UHFFFAOYSA-L |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |