C48H42N4 — CID 102141031
4-N,5-N,9-N,10-N-tetrakis(2,6-dimethylphenyl)pyrene-4,5,9,10-tetraimine (PubChem CID 102141031) has the molecular formula C48H42N4 and a molecular weight of 674.89 g/mol. Its IUPAC name is 4-N,5-N,9-N,10-N-tetrakis(2,6-dimethylphenyl)pyrene-4,5,9,10-tetraimine.
| Compound Name | 4-N,5-N,9-N,10-N-tetrakis(2,6-dimethylphenyl)pyrene-4,5,9,10-tetraimine |
|---|---|
| PubChem CID | 102141031 |
| Molecular Formula | C48H42N4 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 4-N,5-N,9-N,10-N-tetrakis(2,6-dimethylphenyl)pyrene-4,5,9,10-tetraimine |
| SMILES | Cc1cccc(C)c1/N=c1/c(=N/c2c(C)cccc2C)c2cccc3c2-c2c1cccc2c(=N\c1c(C)cccc1C)/c3=N/c1c(C)cccc1C |
| InChI | InChI=1S/C48H42N4/c1-27-15-9-16-28(2)41(27)49-45-35-23-13-25-37-39(35)40-36(46(45)50-42-29(3)17-10-18-30(42)4)24-14-26-38(40)48(52-44-33(7)21-12-22-34(44)8)47(37)51-43-31(5)19-11-20-32(43)6/h9-26H,1-8H3/b49-45+,50-46+,51-47+,52-48+ |
| InChIKey | RQTIWRFGZPPRRE-HUJXRBPWSA-N |
| XLogP | 10.81 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|