C21H25N3OS — CID 88874643
4-tert-butyl-N-[[2-(ethylideneamino)-3-methylphenyl]carbamothioyl]benzamide (PubChem CID 88874643) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[[2-(ethylideneamino)-3-methylphenyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[2-(ethylideneamino)-3-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 88874643 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-tert-butyl-N-[[2-(ethylideneamino)-3-methylphenyl]carbamothioyl]benzamide |
| SMILES | C/C=N/c1c(C)cccc1NC(=S)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25N3OS/c1-6-22-18-14(2)8-7-9-17(18)23-20(26)24-19(25)15-10-12-16(13-11-15)21(3,4)5/h6-13H,1-5H3,(H2,23,24,25,26)/b22-6+ |
| InChIKey | GYMOKOYURVGSRK-GEVRCRHISA-N |
| XLogP | 5.14 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|