C19H21ClN2OS — CID 53371904
4-tert-butyl-N-[(2-chloro-6-methylphenyl)carbamothioyl]benzamide (PubChem CID 53371904) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2-chloro-6-methylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(2-chloro-6-methylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 53371904 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-tert-butyl-N-[(2-chloro-6-methylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cccc(Cl)c1NC(=S)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-12-6-5-7-15(20)16(12)21-18(24)22-17(23)13-8-10-14(11-9-13)19(2,3)4/h5-11H,1-4H3,(H2,21,22,23,24) |
| InChIKey | SNQJTYSQPWWHKS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|