C16H14Cl2N2OS — CID 1342825
2,4-dichloro-N-[(2,6-dimethylphenyl)carbamothioyl]benzamide (PubChem CID 1342825) has the molecular formula C16H14Cl2N2OS and a molecular weight of 353.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2,6-dimethylphenyl)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2,6-dimethylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1342825 |
| Molecular Formula | C16H14Cl2N2OS |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2,4-dichloro-N-[(2,6-dimethylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=S)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2OS/c1-9-4-3-5-10(2)14(9)19-16(22)20-15(21)12-7-6-11(17)8-13(12)18/h3-8H,1-2H3,(H2,19,20,21,22) |
| InChIKey | KJKUUEMBYPOJSG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|