C15H21NO — CID 10466452
1-[(2,6-dimethylphenyl)iminomethyl]cyclohexan-1-ol (PubChem CID 10466452) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[(2,6-dimethylphenyl)iminomethyl]cyclohexan-1-ol.
| Compound Name | 1-[(2,6-dimethylphenyl)iminomethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10466452 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-[(2,6-dimethylphenyl)iminomethyl]cyclohexan-1-ol |
| SMILES | Cc1cccc(C)c1/N=C/C1(O)CCCCC1 |
| InChI | InChI=1S/C15H21NO/c1-12-7-6-8-13(2)14(12)16-11-15(17)9-4-3-5-10-15/h6-8,11,17H,3-5,9-10H2,1-2H3/b16-11+ |
| InChIKey | GYKRHUQIYWRGNP-LFIBNONCSA-N |
| XLogP | 3.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|