C40H54N4 — CID 162408249
1-N,4-N-bis[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]benzene-1,4-diamine (PubChem CID 162408249) has the molecular formula C40H54N4 and a molecular weight of 590.90 g/mol. Its IUPAC name is 1-N,4-N-bis[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 162408249 |
| Molecular Formula | C40H54N4 |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 590.43 |
| IUPAC Name | 1-N,4-N-bis[(Z)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]benzene-1,4-diamine |
| SMILES | C/C(=C/C(C)=N/c1c(C(C)C)cccc1C(C)C)Nc1ccc(N/C(C)=C\C(C)=N\c2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C40H54N4/c1-25(2)35-15-13-16-36(26(3)4)39(35)43-31(11)23-29(9)41-33-19-21-34(22-20-33)42-30(10)24-32(12)44-40-37(27(5)6)17-14-18-38(40)28(7)8/h13-28,41-42H,1-12H3/b29-23-,30-24-,43-31+,44-32+ |
| InChIKey | FJFDDYFNCIGCMI-TVIVAEJHSA-N |
| XLogP | 12.40 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|