C32H38N4 — CID 139160848
1-N,4-N-bis[4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]benzene-1,4-diamine (PubChem CID 139160848) has the molecular formula C32H38N4 and a molecular weight of 478.68 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 139160848 |
| Molecular Formula | C32H38N4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 1-N,4-N-bis[4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]benzene-1,4-diamine |
| SMILES | CC(=C/C(C)=N/c1c(C)cccc1C)Nc1ccc(NC(C)=C/C(C)=N/c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C32H38N4/c1-21-11-9-12-22(2)31(21)35-27(7)19-25(5)33-29-15-17-30(18-16-29)34-26(6)20-28(8)36-32-23(3)13-10-14-24(32)4/h9-20,33-34H,1-8H3/b25-19?,26-20?,35-27+,36-28+ |
| InChIKey | VAEFYCXVMASEKF-ALBWOIIBSA-N |
| XLogP | 9.14 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|