C28H33CoN2- — CID 139119034
cobalt;(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]azanide;toluene (PubChem CID 139119034) has the molecular formula C28H33CoN2- and a molecular weight of 456.52 g/mol. Its IUPAC name is cobalt;(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]azanide;toluene.
| Compound Name | cobalt;(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]azanide;toluene |
|---|---|
| PubChem CID | 139119034 |
| Molecular Formula | C28H33CoN2- |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | cobalt;(2,6-dimethylphenyl)-[(Z)-4-(2,6-dimethylphenyl)iminopent-2-en-2-yl]azanide;toluene |
| SMILES | C/C(=C/C(C)=N/c1c(C)cccc1C)[N-]c1c(C)cccc1C.Cc1ccccc1.[Co] |
| InChI | InChI=1S/C21H25N2.C7H8.Co/c1-14-9-7-10-15(2)20(14)22-18(5)13-19(6)23-21-16(3)11-8-12-17(21)4;1-7-5-3-2-4-6-7;/h7-13H,1-6H3;2-6H,1H3;/q-1;;/b18-13-,23-19+;; |
| InChIKey | MJFRYMHADFNAMF-LJBBPXFASA-N |
| XLogP | 8.61 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|