C28H41N2OZn- — CID 139240491
(2,6-diethylphenyl)-[(Z)-4-(2,6-diethylphenyl)iminopent-2-en-2-yl]azanide;propan-2-ol;zinc (PubChem CID 139240491) has the molecular formula C28H41N2OZn- and a molecular weight of 487.04 g/mol. Its IUPAC name is (2,6-diethylphenyl)-[(Z)-4-(2,6-diethylphenyl)iminopent-2-en-2-yl]azanide;propan-2-ol;zinc.
| Compound Name | (2,6-diethylphenyl)-[(Z)-4-(2,6-diethylphenyl)iminopent-2-en-2-yl]azanide;propan-2-ol;zinc |
|---|---|
| PubChem CID | 139240491 |
| Molecular Formula | C28H41N2OZn- |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2,6-diethylphenyl)-[(Z)-4-(2,6-diethylphenyl)iminopent-2-en-2-yl]azanide;propan-2-ol;zinc |
| SMILES | CC(C)O.CCc1cccc(CC)c1/N=C(C)\C=C(\C)[N-]c1c(CC)cccc1CC.[Zn] |
| InChI | InChI=1S/C25H33N2.C3H8O.Zn/c1-7-20-13-11-14-21(8-2)24(20)26-18(5)17-19(6)27-25-22(9-3)15-12-16-23(25)10-4;1-3(2)4;/h11-17H,7-10H2,1-6H3;3-4H,1-2H3;/q-1;;/b18-17-,27-19-;; |
| InChIKey | FOLBJMOOZNHLHU-FLYBXYBOSA-N |
| XLogP | 8.02 |
| TPSA | 46.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|