C36H31Cl3NOW — CID 135997415
(Z)-3-(2,6-dimethylphenyl)imino-1-(2,4,6-triphenylphenyl)but-1-en-1-ol;trichlorotungsten (PubChem CID 135997415) has the molecular formula C36H31Cl3NOW and a molecular weight of 783.85 g/mol. Its IUPAC name is (Z)-3-(2,6-dimethylphenyl)imino-1-(2,4,6-triphenylphenyl)but-1-en-1-ol;trichlorotungsten.
| Compound Name | (Z)-3-(2,6-dimethylphenyl)imino-1-(2,4,6-triphenylphenyl)but-1-en-1-ol;trichlorotungsten |
|---|---|
| PubChem CID | 135997415 |
| Molecular Formula | C36H31Cl3NOW |
| Molecular Weight | 783.85 g/mol |
| Exact Mass | 782.10 |
| IUPAC Name | (Z)-3-(2,6-dimethylphenyl)imino-1-(2,4,6-triphenylphenyl)but-1-en-1-ol;trichlorotungsten |
| SMILES | CC(/C=C(\O)c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)=N\c1c(C)cccc1C.Cl[W](Cl)Cl |
| InChI | InChI=1S/C36H31NO.3ClH.W/c1-25-14-13-15-26(2)36(25)37-27(3)22-34(38)35-32(29-18-9-5-10-19-29)23-31(28-16-7-4-8-17-28)24-33(35)30-20-11-6-12-21-30;;;;/h4-24,38H,1-3H3;3*1H;/q;;;;+3/p-3/b34-22-,37-27+;;;; |
| InChIKey | SGGVPSYPIDBKHP-VIQLUHQGSA-K |
| XLogP | 12.06 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.85 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|