C23H33N2P — CID 102227374
N-ditert-butylphosphanyl-N'-(2,6-dimethylphenyl)benzenecarboximidamide (PubChem CID 102227374) has the molecular formula C23H33N2P and a molecular weight of 368.51 g/mol. Its IUPAC name is N-ditert-butylphosphanyl-N'-(2,6-dimethylphenyl)benzenecarboximidamide.
| Compound Name | N-ditert-butylphosphanyl-N'-(2,6-dimethylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 102227374 |
| Molecular Formula | C23H33N2P |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | N-ditert-butylphosphanyl-N'-(2,6-dimethylphenyl)benzenecarboximidamide |
| SMILES | Cc1cccc(C)c1/N=C(\NP(C(C)(C)C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H33N2P/c1-17-13-12-14-18(2)20(17)24-21(19-15-10-9-11-16-19)25-26(22(3,4)5)23(6,7)8/h9-16H,1-8H3,(H,24,25) |
| InChIKey | QKWDMKAZWJXLHC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|