C31H33N3O2 — CID 157378283
N-(2,6-dimethylphenyl)benzamide;N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide (PubChem CID 157378283) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)benzamide;N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide.
| Compound Name | N-(2,6-dimethylphenyl)benzamide;N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 157378283 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-(2,6-dimethylphenyl)benzamide;N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide |
| SMILES | Cc1cccc(C)c1/N=C(/c1ccccc1)N(C)O.Cc1cccc(C)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O.C15H15NO/c1-12-8-7-9-13(2)15(12)17-16(18(3)19)14-10-5-4-6-11-14;1-11-7-6-8-12(2)14(11)16-15(17)13-9-4-3-5-10-13/h4-11,19H,1-3H3;3-10H,1-2H3,(H,16,17)/b17-16-; |
| InChIKey | BKONFTVVPADNRA-XYJRJTJESA-N |
| XLogP | 7.26 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|