C20H27Cl3N2O2Ti+ — CID 20752303
N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide;oxolan-1-ium;trichlorotitanium (PubChem CID 20752303) has the molecular formula C20H27Cl3N2O2Ti+ and a molecular weight of 481.67 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide;oxolan-1-ium;trichlorotitanium.
| Compound Name | N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide;oxolan-1-ium;trichlorotitanium |
|---|---|
| PubChem CID | 20752303 |
| Molecular Formula | C20H27Cl3N2O2Ti+ |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-hydroxy-N-methylbenzenecarboximidamide;oxolan-1-ium;trichlorotitanium |
| SMILES | C1CC[OH+]C1.Cc1cccc(C)c1/N=C(\c1ccccc1)N(C)O.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C16H18N2O.C4H8O.3ClH.Ti/c1-12-8-7-9-13(2)15(12)17-16(18(3)19)14-10-5-4-6-11-14;1-2-4-5-3-1;;;;/h4-11,19H,1-3H3;1-4H2;3*1H;/q;;;;;+3/p-2/b17-16+;;;;; |
| InChIKey | MIYQNOPRTOBNLO-YDTRVRFHSA-L |
| XLogP | 6.08 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|