C27H25N2P — CID 142766272
N'-(2,6-dimethylphenyl)-3-diphenylphosphanylbenzenecarboximidamide (PubChem CID 142766272) has the molecular formula C27H25N2P and a molecular weight of 408.49 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-3-diphenylphosphanylbenzenecarboximidamide.
| Compound Name | N'-(2,6-dimethylphenyl)-3-diphenylphosphanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142766272 |
| Molecular Formula | C27H25N2P |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-3-diphenylphosphanylbenzenecarboximidamide |
| SMILES | Cc1cccc(C)c1/N=C(\N)c1cccc(P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H25N2P/c1-20-11-9-12-21(2)26(20)29-27(28)22-13-10-18-25(19-22)30(23-14-5-3-6-15-23)24-16-7-4-8-17-24/h3-19H,1-2H3,(H2,28,29) |
| InChIKey | UTPCOBQNEXGZRF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|