C10H16N6 — CID 175773289
1-(diaminomethylideneamino)-2-(2,6-dimethylphenyl)guanidine (PubChem CID 175773289) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-(diaminomethylideneamino)-2-(2,6-dimethylphenyl)guanidine.
| Compound Name | 1-(diaminomethylideneamino)-2-(2,6-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 175773289 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1-(diaminomethylideneamino)-2-(2,6-dimethylphenyl)guanidine |
| SMILES | Cc1cccc(C)c1/N=C(\N)NN=C(N)N |
| InChI | InChI=1S/C10H16N6/c1-6-4-3-5-7(2)8(6)14-10(13)16-15-9(11)12/h3-5H,1-2H3,(H4,11,12,15)(H3,13,14,16) |
| InChIKey | AEFBEPQXBGSWCE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|