C13H20N4O — CID 135689317
1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-propan-2-ylurea (PubChem CID 135689317) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-propan-2-ylurea.
| Compound Name | 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 135689317 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-propan-2-ylurea |
| SMILES | Cc1cccc(C)c1/N=C(\N)NC(=O)NC(C)C |
| InChI | InChI=1S/C13H20N4O/c1-8(2)15-13(18)17-12(14)16-11-9(3)6-5-7-10(11)4/h5-8H,1-4H3,(H4,14,15,16,17,18) |
| InChIKey | CNNIMVIDOIJTHS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|