C15H23N5O2 — CID 135689292
1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-ethylurea;isocyanatoethane (PubChem CID 135689292) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-ethylurea;isocyanatoethane.
| Compound Name | 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-ethylurea;isocyanatoethane |
|---|---|
| PubChem CID | 135689292 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-3-ethylurea;isocyanatoethane |
| SMILES | CCN=C=O.CCNC(=O)N/C(N)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C12H18N4O.C3H5NO/c1-4-14-12(17)16-11(13)15-10-8(2)6-5-7-9(10)3;1-2-4-3-5/h5-7H,4H2,1-3H3,(H4,13,14,15,16,17);2H2,1H3 |
| InChIKey | IYXYFNDCBIXXSF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|