About 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane
1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane (PubChem CID 162038032) has the molecular formula C12H16N4O4
and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane.
Molecular Properties
| Compound Name | 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane |
| PubChem CID | 162038032 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane |
| SMILES | CCN=C=O.CCNC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H11N3O3.C3H5NO/c1-2-10-9(13)11-7-3-5-8(6-4-7)12(14)15;1-2-4-3-5/h3-6H,2H2,1H3,(H2,10,11,13);2H2,1H3 |
| InChIKey | YWXFWLZJNCWCAJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane?
The IUPAC name of 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane (CID 162038032) is 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane.
What is the SMILES notation for 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane?
The canonical SMILES for 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane is CCN=C=O.CCNC(=O)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane?
The InChIKey is YWXFWLZJNCWCAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3.C3H5NO/c1-2-10-9(13)11-7-3-5-8(6-4-7)12(14)15;1-2-4-3-5/h3-6H,2H2,1H3,(H2,10,11,13);2H2,1H3.
What are the key properties of 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane?
1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane has a molecular weight of 280.28 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(4-nitrophenyl)urea;isocyanatoethane is sourced from PubChem (CID 162038032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).