C24H26N4O — CID 135689284
1,1-dibenzyl-3-[N'-(2,6-dimethylphenyl)carbamimidoyl]urea (PubChem CID 135689284) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[N'-(2,6-dimethylphenyl)carbamimidoyl]urea.
| Compound Name | 1,1-dibenzyl-3-[N'-(2,6-dimethylphenyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135689284 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1,1-dibenzyl-3-[N'-(2,6-dimethylphenyl)carbamimidoyl]urea |
| SMILES | Cc1cccc(C)c1/N=C(\N)NC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26N4O/c1-18-10-9-11-19(2)22(18)26-23(25)27-24(29)28(16-20-12-5-3-6-13-20)17-21-14-7-4-8-15-21/h3-15H,16-17H2,1-2H3,(H3,25,26,27,29) |
| InChIKey | MNNFVORTEILYFX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|