C14H21N5O2 — CID 20543515
1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-1,3-dimethylurea;methylimino(oxo)methane (PubChem CID 20543515) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-1,3-dimethylurea;methylimino(oxo)methane.
| Compound Name | 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-1,3-dimethylurea;methylimino(oxo)methane |
|---|---|
| PubChem CID | 20543515 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-[N'-(2,6-dimethylphenyl)carbamimidoyl]-1,3-dimethylurea;methylimino(oxo)methane |
| SMILES | CN=C=O.CNC(=O)N(C)/C(N)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C12H18N4O.C2H3NO/c1-8-6-5-7-9(2)10(8)15-11(13)16(4)12(17)14-3;1-3-2-4/h5-7H,1-4H3,(H2,13,15)(H,14,17);1H3 |
| InChIKey | KVPMEIXKRTUVCR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|