C10H12N2O — CID 135267076
N,3-dimethyl-2-(methylideneamino)benzamide (PubChem CID 135267076) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is N,3-dimethyl-2-(methylideneamino)benzamide.
| Compound Name | N,3-dimethyl-2-(methylideneamino)benzamide |
|---|---|
| PubChem CID | 135267076 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N,3-dimethyl-2-(methylideneamino)benzamide |
| SMILES | C=Nc1c(C)cccc1C(=O)NC |
| InChI | InChI=1S/C10H12N2O/c1-7-5-4-6-8(9(7)11-2)10(13)12-3/h4-6H,2H2,1,3H3,(H,12,13) |
| InChIKey | SAQGWVMNKINPKG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|