C9H11BF3NO — CID 174957672
N,2-dimethylbenzamide;trifluoroborane (PubChem CID 174957672) has the molecular formula C9H11BF3NO and a molecular weight of 217.00 g/mol. Its IUPAC name is N,2-dimethylbenzamide;trifluoroborane.
| Compound Name | N,2-dimethylbenzamide;trifluoroborane |
|---|---|
| PubChem CID | 174957672 |
| Molecular Formula | C9H11BF3NO |
| Molecular Weight | 217.00 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N,2-dimethylbenzamide;trifluoroborane |
| SMILES | CNC(=O)c1ccccc1C.FB(F)F |
| InChI | InChI=1S/C9H11NO.BF3/c1-7-5-3-4-6-8(7)9(11)10-2;2-1(3)4/h3-6H,1-2H3,(H,10,11); |
| InChIKey | BRMXNGIAWCLCLO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.00 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|