About formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol
formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol (PubChem CID 143934815) has the molecular formula C14H22N2O2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol.
Molecular Properties
| Compound Name | formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol |
| PubChem CID | 143934815 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol |
| SMILES | C=Nc1c(C)cccc1S.C=O.CCCC(=O)NC |
| InChI | InChI=1S/C8H9NS.C5H11NO.CH2O/c1-6-4-3-5-7(10)8(6)9-2;1-3-4-5(7)6-2;1-2/h3-5,10H,2H2,1H3;3-4H2,1-2H3,(H,6,7);1H2 |
| InChIKey | ZAQZEGXZXJBTLB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol?
The IUPAC name of formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol (CID 143934815) is formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol.
What is the SMILES notation for formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol?
The canonical SMILES for formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol is C=Nc1c(C)cccc1S.C=O.CCCC(=O)NC.
What is the InChIKey of formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol?
The InChIKey is ZAQZEGXZXJBTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS.C5H11NO.CH2O/c1-6-4-3-5-7(10)8(6)9-2;1-3-4-5(7)6-2;1-2/h3-5,10H,2H2,1H3;3-4H2,1-2H3,(H,6,7);1H2.
What are the key properties of formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol?
formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol has a molecular weight of 282.41 g/mol, XLogP of 2.96, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;N-methylbutanamide;3-methyl-2-(methylideneamino)benzenethiol is sourced from PubChem (CID 143934815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).