About benzo[g][1]benzofuran;N-methylbutanamide
benzo[g][1]benzofuran;N-methylbutanamide (PubChem CID 174308146) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is benzo[g][1]benzofuran;N-methylbutanamide.
Molecular Properties
| Compound Name | benzo[g][1]benzofuran;N-methylbutanamide |
| PubChem CID | 174308146 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | benzo[g][1]benzofuran;N-methylbutanamide |
| SMILES | CCCC(=O)NC.c1ccc2c(c1)ccc1ccoc12 |
| InChI | InChI=1S/C12H8O.C5H11NO/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11;1-3-4-5(7)6-2/h1-8H;3-4H2,1-2H3,(H,6,7) |
| InChIKey | NLNGDEPOCUTQFW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[g][1]benzofuran;N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g][1]benzofuran;N-methylbutanamide?
The IUPAC name of benzo[g][1]benzofuran;N-methylbutanamide (CID 174308146) is benzo[g][1]benzofuran;N-methylbutanamide.
What is the SMILES notation for benzo[g][1]benzofuran;N-methylbutanamide?
The canonical SMILES for benzo[g][1]benzofuran;N-methylbutanamide is CCCC(=O)NC.c1ccc2c(c1)ccc1ccoc12.
What is the InChIKey of benzo[g][1]benzofuran;N-methylbutanamide?
The InChIKey is NLNGDEPOCUTQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.C5H11NO/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11;1-3-4-5(7)6-2/h1-8H;3-4H2,1-2H3,(H,6,7).
What are the key properties of benzo[g][1]benzofuran;N-methylbutanamide?
benzo[g][1]benzofuran;N-methylbutanamide has a molecular weight of 269.34 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g][1]benzofuran;N-methylbutanamide is sourced from PubChem (CID 174308146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).