C18H29NO — CID 15323884
4-(2,6-dimethylphenyl)imino-2,2,5,5-tetramethylhexan-3-ol (PubChem CID 15323884) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)imino-2,2,5,5-tetramethylhexan-3-ol.
| Compound Name | 4-(2,6-dimethylphenyl)imino-2,2,5,5-tetramethylhexan-3-ol |
|---|---|
| PubChem CID | 15323884 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 4-(2,6-dimethylphenyl)imino-2,2,5,5-tetramethylhexan-3-ol |
| SMILES | Cc1cccc(C)c1/N=C(/C(O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO/c1-12-10-9-11-13(2)14(12)19-15(17(3,4)5)16(20)18(6,7)8/h9-11,16,20H,1-8H3/b19-15- |
| InChIKey | UPAQFSUSSPLRSO-CYVLTUHYSA-N |
| XLogP | 4.83 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|