C17H20N4 — CID 175260191
3-N-[4-(3-aminophenyl)iminopent-2-en-2-yl]benzene-1,3-diamine (PubChem CID 175260191) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 3-N-[4-(3-aminophenyl)iminopent-2-en-2-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[4-(3-aminophenyl)iminopent-2-en-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 175260191 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3-N-[4-(3-aminophenyl)iminopent-2-en-2-yl]benzene-1,3-diamine |
| SMILES | CC(=C/C(C)=N/c1cccc(N)c1)Nc1cccc(N)c1 |
| InChI | InChI=1S/C17H20N4/c1-12(20-16-7-3-5-14(18)10-16)9-13(2)21-17-8-4-6-15(19)11-17/h3-11,20H,18-19H2,1-2H3/b12-9?,21-13+ |
| InChIKey | HGGNOKGKUPZFHW-JVYLJVOKSA-N |
| XLogP | 3.96 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|