About hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride
hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride (PubChem CID 174144711) has the molecular formula C17H17ClN2
and a molecular weight of 284.79 g/mol. Its IUPAC name is hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride.
Molecular Properties
| Compound Name | hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride |
| PubChem CID | 174144711 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride |
| SMILES | C(=C/C=N/c1ccccc1)/C=C/Nc1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-15,18H;1H/b9-3?,14-8+,19-15+; |
| InChIKey | VUCMMJBDNXZQDJ-VOZVYVGNSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride?
The IUPAC name of hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride (CID 174144711) is hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride.
What is the SMILES notation for hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride?
The canonical SMILES for hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride is C(=C/C=N/c1ccccc1)/C=C/Nc1ccccc1.[Cl-].[H+].
What is the InChIKey of hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride?
The InChIKey is VUCMMJBDNXZQDJ-VOZVYVGNSA-N. The full InChI is InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-15,18H;1H/b9-3?,14-8+,19-15+;.
What are the key properties of hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride?
hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride has a molecular weight of 284.79 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;N-[(1E)-5-phenyliminopenta-1,3-dienyl]aniline;chloride is sourced from PubChem (CID 174144711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).