C16H21N2+ — CID 123995798
8-anilinoocta-3,5,7-trien-2-ylidene(dimethyl)azanium (PubChem CID 123995798) has the molecular formula C16H21N2+ and a molecular weight of 241.36 g/mol. Its IUPAC name is 8-anilinoocta-3,5,7-trien-2-ylidene(dimethyl)azanium.
| Compound Name | 8-anilinoocta-3,5,7-trien-2-ylidene(dimethyl)azanium |
|---|---|
| PubChem CID | 123995798 |
| Molecular Formula | C16H21N2+ |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 8-anilinoocta-3,5,7-trien-2-ylidene(dimethyl)azanium |
| SMILES | CC(C=CC=CC=CNc1ccccc1)=[N+](C)C |
| InChI | InChI=1S/C16H20N2/c1-15(18(2)3)11-7-4-5-10-14-17-16-12-8-6-9-13-16/h4-14H,1-3H3/p+1 |
| InChIKey | BVIBCGRDZODPJH-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|