C16H21N — CID 118027593
N-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]aniline (PubChem CID 118027593) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]aniline.
| Compound Name | N-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 118027593 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]aniline |
| SMILES | C=C/C(=C\C=C\Nc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H21N/c1-5-14(16(2,3)4)10-9-13-17-15-11-7-6-8-12-15/h5-13,17H,1H2,2-4H3/b13-9+,14-10+ |
| InChIKey | PZVZYXPSFPNRGX-UTLPMFLDSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|