C17H26N2 — CID 126659367
(Z)-N'-[(E)-3,4-dimethylhex-4-en-2-yl]-N'-methyl-N-phenylethene-1,2-diamine (PubChem CID 126659367) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (Z)-N'-[(E)-3,4-dimethylhex-4-en-2-yl]-N'-methyl-N-phenylethene-1,2-diamine.
| Compound Name | (Z)-N'-[(E)-3,4-dimethylhex-4-en-2-yl]-N'-methyl-N-phenylethene-1,2-diamine |
|---|---|
| PubChem CID | 126659367 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (Z)-N'-[(E)-3,4-dimethylhex-4-en-2-yl]-N'-methyl-N-phenylethene-1,2-diamine |
| SMILES | C/C=C(\C)C(C)C(C)N(C)/C=C\Nc1ccccc1 |
| InChI | InChI=1S/C17H26N2/c1-6-14(2)15(3)16(4)19(5)13-12-18-17-10-8-7-9-11-17/h6-13,15-16,18H,1-5H3/b13-12-,14-6+ |
| InChIKey | KPIFCSHALWNJJE-IBWGPUADSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|