C15H21N — CID 134513247
N-[(1Z,3Z)-3-ethyl-5-methylhexa-1,3-dienyl]aniline (PubChem CID 134513247) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-ethyl-5-methylhexa-1,3-dienyl]aniline.
| Compound Name | N-[(1Z,3Z)-3-ethyl-5-methylhexa-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 134513247 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-[(1Z,3Z)-3-ethyl-5-methylhexa-1,3-dienyl]aniline |
| SMILES | CCC(/C=C\Nc1ccccc1)=C/C(C)C |
| InChI | InChI=1S/C15H21N/c1-4-14(12-13(2)3)10-11-16-15-8-6-5-7-9-15/h5-13,16H,4H2,1-3H3/b11-10-,14-12- |
| InChIKey | YMMHHPDNAHMCMQ-QDUUWUCGSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|