C14H19NO2 — CID 135045536
(Z)-1-anilino-4-hydroxy-5,5-dimethylhex-1-en-3-one (PubChem CID 135045536) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (Z)-1-anilino-4-hydroxy-5,5-dimethylhex-1-en-3-one.
| Compound Name | (Z)-1-anilino-4-hydroxy-5,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 135045536 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (Z)-1-anilino-4-hydroxy-5,5-dimethylhex-1-en-3-one |
| SMILES | CC(C)(C)C(O)C(=O)/C=C\Nc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-14(2,3)13(17)12(16)9-10-15-11-7-5-4-6-8-11/h4-10,13,15,17H,1-3H3/b10-9- |
| InChIKey | ABOJBTVAHMZDQZ-KTKRTIGZSA-N |
| XLogP | 2.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|