C18H19N2+ — CID 58771556
[(2E,4E)-5-anilino-3-methylpenta-2,4-dienylidene]-phenylazanium (PubChem CID 58771556) has the molecular formula C18H19N2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is [(2E,4E)-5-anilino-3-methylpenta-2,4-dienylidene]-phenylazanium.
| Compound Name | [(2E,4E)-5-anilino-3-methylpenta-2,4-dienylidene]-phenylazanium |
|---|---|
| PubChem CID | 58771556 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [(2E,4E)-5-anilino-3-methylpenta-2,4-dienylidene]-phenylazanium |
| SMILES | CC(/C=C/Nc1ccccc1)=C\C=[NH+]\c1ccccc1 |
| InChI | InChI=1S/C18H18N2/c1-16(12-14-19-17-8-4-2-5-9-17)13-15-20-18-10-6-3-7-11-18/h2-15,19H,1H3/p+1/b14-12+,16-13+,20-15+ |
| InChIKey | KUCBDXVMDNTEAT-ZDQRNAQRSA-O |
| XLogP | 3.04 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|