C12H16N2 — CID 150631626
1-N,4-N-bis(prop-1-enyl)benzene-1,4-diamine (PubChem CID 150631626) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-N,4-N-bis(prop-1-enyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(prop-1-enyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 150631626 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-N,4-N-bis(prop-1-enyl)benzene-1,4-diamine |
| SMILES | CC=CNc1ccc(NC=CC)cc1 |
| InChI | InChI=1S/C12H16N2/c1-3-9-13-11-5-7-12(8-6-11)14-10-4-2/h3-10,13-14H,1-2H3 |
| InChIKey | IXZVPDXFMXUOKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |