C16H21N3 — CID 106750291
4-N-(4-tert-butylphenyl)benzene-1,2,4-triamine (PubChem CID 106750291) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 4-N-(4-tert-butylphenyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(4-tert-butylphenyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750291 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4-N-(4-tert-butylphenyl)benzene-1,2,4-triamine |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C16H21N3/c1-16(2,3)11-4-6-12(7-5-11)19-13-8-9-14(17)15(18)10-13/h4-10,19H,17-18H2,1-3H3 |
| InChIKey | JEHOZIKFXRVTPL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|