C24H31N5 — CID 101085708
4-N,6-N-bis(4-tert-butylphenyl)pyrimidine-2,4,6-triamine (PubChem CID 101085708) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is 4-N,6-N-bis(4-tert-butylphenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(4-tert-butylphenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 101085708 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 4-N,6-N-bis(4-tert-butylphenyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)(C)c1ccc(Nc2cc(Nc3ccc(C(C)(C)C)cc3)nc(N)n2)cc1 |
| InChI | InChI=1S/C24H31N5/c1-23(2,3)16-7-11-18(12-8-16)26-20-15-21(29-22(25)28-20)27-19-13-9-17(10-14-19)24(4,5)6/h7-15H,1-6H3,(H4,25,26,27,28,29) |
| InChIKey | DDYMGBIUWCGPRY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |