C27H38N2 — CID 167383872
1-N-(4-tert-butylphenyl)-3-N-[(5E)-2,7,7-trimethylocta-1,5-dien-3-yl]benzene-1,3-diamine (PubChem CID 167383872) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-N-(4-tert-butylphenyl)-3-N-[(5E)-2,7,7-trimethylocta-1,5-dien-3-yl]benzene-1,3-diamine.
| Compound Name | 1-N-(4-tert-butylphenyl)-3-N-[(5E)-2,7,7-trimethylocta-1,5-dien-3-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 167383872 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 1-N-(4-tert-butylphenyl)-3-N-[(5E)-2,7,7-trimethylocta-1,5-dien-3-yl]benzene-1,3-diamine |
| SMILES | C=C(C)C(C/C=C/C(C)(C)C)Nc1cccc(Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C27H38N2/c1-20(2)25(13-10-18-26(3,4)5)29-24-12-9-11-23(19-24)28-22-16-14-21(15-17-22)27(6,7)8/h9-12,14-19,25,28-29H,1,13H2,2-8H3/b18-10+ |
| InChIKey | GEBOHTBZFQBXTA-VCHYOVAHSA-N |
| XLogP | 8.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|