C17H17N — CID 91209631
3-(3-methylbuta-1,3-dienyl)-N-phenylaniline (PubChem CID 91209631) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-(3-methylbuta-1,3-dienyl)-N-phenylaniline.
| Compound Name | 3-(3-methylbuta-1,3-dienyl)-N-phenylaniline |
|---|---|
| PubChem CID | 91209631 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-(3-methylbuta-1,3-dienyl)-N-phenylaniline |
| SMILES | C=C(C)C=Cc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C17H17N/c1-14(2)11-12-15-7-6-10-17(13-15)18-16-8-4-3-5-9-16/h3-13,18H,1H2,2H3 |
| InChIKey | PNZCRKDHOPATRZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|