C18H24N4O2S — CID 126849937
tert-butyl 4-[(6-thiophen-3-ylpyrimidin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 126849937) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is tert-butyl 4-[(6-thiophen-3-ylpyrimidin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-thiophen-3-ylpyrimidin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126849937 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl 4-[(6-thiophen-3-ylpyrimidin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(-c3ccsc3)ncn2)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c1-18(2,3)24-17(23)22-7-4-14(5-8-22)21-16-10-15(19-12-20-16)13-6-9-25-11-13/h6,9-12,14H,4-5,7-8H2,1-3H3,(H,19,20,21) |
| InChIKey | BEVYJZZESQDSQT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |