C27H24FN7O3 — CID 162683402
tert-butyl 3-fluoro-5-[2-[2-[2-[(Z)-[(3S)-3-hydroxycyclopentylidene]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate (PubChem CID 162683402) has the molecular formula C27H24FN7O3 and a molecular weight of 513.53 g/mol. Its IUPAC name is tert-butyl 3-fluoro-5-[2-[2-[2-[(Z)-[(3S)-3-hydroxycyclopentylidene]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-5-[2-[2-[2-[(Z)-[(3S)-3-hydroxycyclopentylidene]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 162683402 |
| Molecular Formula | C27H24FN7O3 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | tert-butyl 3-fluoro-5-[2-[2-[2-[(Z)-[(3S)-3-hydroxycyclopentylidene]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(F)c2cc(C#Cc3ccnc(-c4ccnc(/N=C5/CC[C@H](O)C5)n4)n3)ccc21 |
| InChI | InChI=1S/C27H24FN7O3/c1-27(2,3)38-26(37)35-22-9-5-16(14-20(22)23(28)34-35)4-6-17-10-12-29-24(31-17)21-11-13-30-25(33-21)32-18-7-8-19(36)15-18/h5,9-14,19,36H,7-8,15H2,1-3H3/b32-18-/t19-/m0/s1 |
| InChIKey | WCOJPWIKIIVLLD-RVOUIRKHSA-N |
| XLogP | 4.22 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|