C13H13F3N2O5S — CID 54533813
tert-butyl 6-(trifluoromethylsulfonyloxy)indazole-1-carboxylate (PubChem CID 54533813) has the molecular formula C13H13F3N2O5S and a molecular weight of 366.32 g/mol. Its IUPAC name is tert-butyl 6-(trifluoromethylsulfonyloxy)indazole-1-carboxylate.
| Compound Name | tert-butyl 6-(trifluoromethylsulfonyloxy)indazole-1-carboxylate |
|---|---|
| PubChem CID | 54533813 |
| Molecular Formula | C13H13F3N2O5S |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | tert-butyl 6-(trifluoromethylsulfonyloxy)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H13F3N2O5S/c1-12(2,3)22-11(19)18-10-6-9(5-4-8(10)7-17-18)23-24(20,21)13(14,15)16/h4-7H,1-3H3 |
| InChIKey | YYJZIPONRAWASO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|