C16H21NO5 — CID 18914660
acetic acid;tert-butyl 5-hydroxy-2-methylindole-1-carboxylate (PubChem CID 18914660) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is acetic acid;tert-butyl 5-hydroxy-2-methylindole-1-carboxylate.
| Compound Name | acetic acid;tert-butyl 5-hydroxy-2-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 18914660 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | acetic acid;tert-butyl 5-hydroxy-2-methylindole-1-carboxylate |
| SMILES | CC(=O)O.Cc1cc2cc(O)ccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H17NO3.C2H4O2/c1-9-7-10-8-11(16)5-6-12(10)15(9)13(17)18-14(2,3)4;1-2(3)4/h5-8,16H,1-4H3;1H3,(H,3,4) |
| InChIKey | NKCJDHJAGUTGKL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |