C15H18FNO5S — CID 146349300
tert-butyl 5-fluoro-2-(methylsulfonyloxymethyl)indole-1-carboxylate (PubChem CID 146349300) has the molecular formula C15H18FNO5S and a molecular weight of 343.38 g/mol. Its IUPAC name is tert-butyl 5-fluoro-2-(methylsulfonyloxymethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-fluoro-2-(methylsulfonyloxymethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 146349300 |
| Molecular Formula | C15H18FNO5S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | tert-butyl 5-fluoro-2-(methylsulfonyloxymethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(COS(C)(=O)=O)cc2cc(F)ccc21 |
| InChI | InChI=1S/C15H18FNO5S/c1-15(2,3)22-14(18)17-12(9-21-23(4,19)20)8-10-7-11(16)5-6-13(10)17/h5-8H,9H2,1-4H3 |
| InChIKey | DVNKHUCITOGOEO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|