C22H35NO6SSi — CID 175046296
tert-butyl 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-methylsulfonyloxyethyl]indole-1-carboxylate (PubChem CID 175046296) has the molecular formula C22H35NO6SSi and a molecular weight of 469.68 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-methylsulfonyloxyethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-methylsulfonyloxyethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 175046296 |
| Molecular Formula | C22H35NO6SSi |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | tert-butyl 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-methylsulfonyloxyethyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(C[C@@H](O[Si](C)(C)C(C)(C)C)OS(C)(=O)=O)cc2ccccc21 |
| InChI | InChI=1S/C22H35NO6SSi/c1-21(2,3)27-20(24)23-17(14-16-12-10-11-13-18(16)23)15-19(28-30(7,25)26)29-31(8,9)22(4,5)6/h10-14,19H,15H2,1-9H3/t19-/m1/s1 |
| InChIKey | IIIBQWAMBPCVNJ-LJQANCHMSA-N |
| XLogP | 5.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|